Difference between revisions of "Tiso gene 6898"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLMETHIONINE N-FORMYLMETHIONINE] == * smiles: ** CSCCC(N[CH]=O)C(=O)[O-] * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROHYDROXYPHOSPHORYLPYRUVATE 3-HYDROHYDROXYPHOSPHORYLPYRUVATE] == * smiles: ** C([O-])(=O)C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROHYDROXYPHOSPHORYLPYRUVATE 3-HYDROHYDROXYPHOSPHORYLPYRUVATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C([O-])(=O)C(=O)C[PH]([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VHAFWRWGHGSZDL-UHFFFAOYSA-L |
* common name: | * common name: | ||
| − | ** | + | ** phosphinopyruvate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 150.027 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-[hydroxy(oxido)phosphoranyl]pyruvic acid |
| − | ** | + | ** 3-(hydrohydroxyphosphoryl)pyruvate |
| − | ** | + | ** (hydroxyphosphinyl)pyruvate |
| + | ** PPA | ||
| + | ** 3-hydrohydroxyphosphorylpyruvate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10828]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[2.7.8.23-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21722341 21722341] |
| − | * | + | * CHEMSPIDER: |
| − | + | ** [http://www.chemspider.com/Chemical-Structure.10306741.html 10306741] | |
| − | ** [http://www. | + | |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58348 58348] |
| − | {{#set: smiles= | + | * LIGAND-CPD: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06368 C06368] |
| − | {{#set: common name= | + | {{#set: smiles=C([O-])(=O)C(=O)C[PH]([O-])=O}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=VHAFWRWGHGSZDL-UHFFFAOYSA-L}} |
| − | {{#set: common name= | + | {{#set: common name=phosphinopyruvate}} |
| − | {{#set: | + | {{#set: molecular weight=150.027 }} |
| + | {{#set: common name=3-[hydroxy(oxido)phosphoranyl]pyruvic acid|3-(hydrohydroxyphosphoryl)pyruvate|(hydroxyphosphinyl)pyruvate|PPA|3-hydrohydroxyphosphorylpyruvate}} | ||
| + | {{#set: produced by=RXN-10828}} | ||
| + | {{#set: reversible reaction associated=2.7.8.23-RXN}} | ||
Revision as of 18:52, 18 March 2018
Contents
Metabolite 3-HYDROHYDROXYPHOSPHORYLPYRUVATE
- smiles:
- C([O-])(=O)C(=O)C[PH]([O-])=O
- inchi key:
- InChIKey=VHAFWRWGHGSZDL-UHFFFAOYSA-L
- common name:
- phosphinopyruvate
- molecular weight:
- 150.027
- Synonym(s):
- 3-[hydroxy(oxido)phosphoranyl]pyruvic acid
- 3-(hydrohydroxyphosphoryl)pyruvate
- (hydroxyphosphinyl)pyruvate
- PPA
- 3-hydrohydroxyphosphorylpyruvate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C(=O)C[PH]([O-])=O" cannot be used as a page name in this wiki.
"3-[hydroxy(oxido)phosphoranyl]pyruvic acid" cannot be used as a page name in this wiki.
