Difference between revisions of "O-SUCCHOMOSERLYASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4467 == * left end position: ** 9357 * transcription direction: ** POSITIVE * right end position: ** 11138 * centisome position: ** 63.1717...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * smiles: ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] *...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_4467 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] ==
−
* left end position:
+
* smiles:
−
** 9357
+
** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L
−
* right end position:
+
* common name:
−
** 11138
+
** 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
−
* centisome position:
+
* molecular weight:
−
** 63.17175    
+
** 353.228    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PANTOTHENATE-KIN-RXN]]
+
* [[RXN-10058]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PANTO-PWY]]
+
−
* [[PWY-3961]]
+
−
* [[COA-PWY-1]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=9357}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480553 45480553]
−
{{#set: right end position=11138}}
+
* CHEBI:
−
{{#set: centisome position=63.17175   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58890 58890]
−
{{#set: reaction associated=PANTOTHENATE-KIN-RXN}}
+
{{#set: smiles=C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
−
{{#set: pathway associated=PANTO-PWY|PWY-3961|COA-PWY-1}}
+
{{#set: inchi key=InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L}}
 +
{{#set: common name=2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one}}
 +
{{#set: molecular weight=353.228   }}
 +
{{#set: common name=2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate}}
 +
{{#set: consumed by=RXN-10058}}

Revision as of 18:52, 18 March 2018

Metabolite CPD-10809

  • smiles:
    • C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]
  • inchi key:
    • InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L
  • common name:
    • 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
  • molecular weight:
    • 353.228
  • Synonym(s):
    • 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=O-SUCCHOMOSERLYASE-RXN&oldid=27501"