Difference between revisions of "Tiso gene 4415"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * smiles: ** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R524-RXN R524-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** cyanate_hydratase * ec number...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R524-RXN R524-RXN] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(7Z)-hexadecenoyl-CoA
+
** cyanate_hydratase
−
* molecular weight:
+
* ec number:
−
** 1013.883   
+
** [http://enzyme.expasy.org/EC/4.2.1.104 EC-4.2.1.104]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-16:1-Δ7-CoA
 
−
** 3-oxo-7-cis-hexadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17782]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-69]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[HCO3]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CARBAMATE]][c]
−
* [[RXN-17781]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 cyanate[c] '''+''' 1 H+[c] '''+''' 1 hydrogencarbonate[c] '''=>''' 1 CO2[c] '''+''' 1 carbamate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_15128]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
** EXPERIMENTAL_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
** [[pantograph]]-[[athaliana]]
 +
== Pathways  ==
 +
* [[CYANCAT-PWY]], cyanate degradation: [http://metacyc.org/META/NEW-IMAGE?object=CYANCAT-PWY CYANCAT-PWY]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* RHEA:
−
{{#set: inchi key=InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J}}
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18489 18489]
−
{{#set: common name=3-oxo-(7Z)-hexadecenoyl-CoA}}
+
* LIGAND-RXN:
−
{{#set: molecular weight=1013.883    }}
+
** [http://www.genome.jp/dbget-bin/www_bget?R03546 R03546]
−
{{#set: common name=3-oxo-16:1-Δ7-CoA|3-oxo-7-cis-hexadecenoyl-CoA}}
+
* UNIPROT:
−
{{#set: consumed by=RXN-17782}}
+
** [http://www.uniprot.org/uniprot/P00816 P00816]
−
{{#set: produced by=RXN-17781}}
+
** [http://www.uniprot.org/uniprot/Q55367 Q55367]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=cyanate_hydratase}}
 +
{{#set: ec number=EC-4.2.1.104}}
 +
{{#set: gene associated=Tiso_gene_15128}}
 +
{{#set: in pathway=CYANCAT-PWY}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-athaliana|annotation-experimental_annotation}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Revision as of 18:52, 18 March 2018

Reaction R524-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cyanate_hydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4415&oldid=27505"