Difference between revisions of "1.8.1.4-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17367 CPD-17367] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14917 RXN-14917] == * direction: ** LEFT-TO-RIGHT * common name: ** mpbq_msbq_methyltransferase...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17367 CPD-17367] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14917 RXN-14917] ==
−
* smiles:
+
* direction:
−
** CCCCCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JHXLRLHTJYMVBK-DHDHVEHBSA-J
+
 
* common name:
 
* common name:
−
** (3R)-hydroxy-adrenoyl-CoA
+
** mpbq_msbq_methyltransferase
−
* molecular weight:
+
* ec number:
−
** 1094.012   
+
** [http://enzyme.expasy.org/EC/2.1.1.295 EC-2.1.1.295]
 
* Synonym(s):
 
* Synonym(s):
−
** (3R)-hydroxy-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA
 
−
** (3R)--hydroxy-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-16112]]
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[CPD-11712]][c] '''=>''' 1 [[CPD-15834]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 S-adenosyl-L-methionine[c] '''+''' 1 2-methyl-6-geranylgeranyl-1,4-benzoquinol[c] '''=>''' 1 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_2596]]
 +
** IN-SILICO_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-7436]], vitamin E biosynthesis (tocotrienols): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7436 PWY-7436]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193769 72193769]
+
{{#set: common name=mpbq_msbq_methyltransferase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.1.1.295}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76415 76415]
+
{{#set: gene associated=Tiso_gene_2596}}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: in pathway=PWY-7436}}
−
{{#set: inchi key=InChIKey=JHXLRLHTJYMVBK-DHDHVEHBSA-J}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=(3R)-hydroxy-adrenoyl-CoA}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: molecular weight=1094.012    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=(3R)-hydroxy-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA|(3R)--hydroxy-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA}}
+
−
{{#set: produced by=RXN-16112}}
+

Revision as of 18:52, 18 March 2018

Reaction RXN-14917

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • mpbq_msbq_methyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 S-adenosyl-L-methionine[c] + 1 2-methyl-6-geranylgeranyl-1,4-benzoquinol[c] => 1 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol[c] + 1 S-adenosyl-L-homocysteine[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7436, vitamin E biosynthesis (tocotrienols): PWY-7436
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1.8.1.4-RXN&oldid=27510"