Difference between revisions of "Tiso gene 5703"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D7-25-C44-3-ACPs trans-D2-cis-cis-D7-25-C44-3-ACPs] == * common name: ** a tra...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D7-25-C44-3-ACPs trans-D2-cis-cis-D7-25-C44-3-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a trans-delta2-cis,cis-delta7,25-C44:3-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a trans-delta2-cis,cis-delta7,25-C44:3-[acyl-carrier-protein] |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1G-468]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a trans-delta2-cis,cis-delta7,25-C44:3-[acp]}} | |
| − | + | {{#set: common name=a trans-delta2-cis,cis-delta7,25-C44:3-[acyl-carrier-protein]}} | |
| − | + | {{#set: consumed by=RXN1G-468}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 18:53, 18 March 2018
Contents
Metabolite trans-D2-cis-cis-D7-25-C44-3-ACPs
- common name:
- a trans-delta2-cis,cis-delta7,25-C44:3-[acp]
- Synonym(s):
- a trans-delta2-cis,cis-delta7,25-C44:3-[acyl-carrier-protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a trans-delta2-cis,cis-delta7,25-C44:3-[acp" cannot be used as a page name in this wiki.
"a trans-delta2-cis,cis-delta7,25-C44:3-[acyl-carrier-protein" cannot be used as a page name in this wiki.
