Difference between revisions of "Tiso gene 12997"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O * inchi key: ** In...")
(Created page with "Category:Gene == Gene Tiso_gene_8252 == * left end position: ** 7002 * transcription direction: ** POSITIVE * right end position: ** 9571 * centisome position: ** 67.13971...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] ==
+
== Gene Tiso_gene_8252 ==
−
* smiles:
+
* left end position:
−
** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O
+
** 7002
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** paraoxon
+
** 9571
−
* molecular weight:
+
* centisome position:
−
** 275.197    
+
** 67.13971    
 
* Synonym(s):
 
* Synonym(s):
−
** O,O-diethyl-O-p-nitrophenylphosphoric acid
 
−
** diethyl-p-nitrophenyl phosphate
 
−
** phosphoric acid diethyl 4-nitrophenyl ester
 
−
** diethyl paraoxon
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8746]]
+
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 311-45-5
+
{{#set: left end position=7002}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9395 9395]
+
{{#set: right end position=9571}}
−
* HMDB : HMDB13035
+
{{#set: centisome position=67.13971   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PROTEIN-TYROSINE-PHOSPHATASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06606 C06606]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.9026.html 9026]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27827 27827]
+
−
{{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O}}
+
−
{{#set: inchi key=InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N}}
+
−
{{#set: common name=paraoxon}}
+
−
{{#set: molecular weight=275.197   }}
+
−
{{#set: common name=O,O-diethyl-O-p-nitrophenylphosphoric acid|diethyl-p-nitrophenyl phosphate|phosphoric acid diethyl 4-nitrophenyl ester|diethyl paraoxon}}
+
−
{{#set: consumed by=RXN-8746}}
+

Revision as of 18:53, 18 March 2018

Gene Tiso_gene_8252

  • left end position:
    • 7002
  • transcription direction:
    • POSITIVE
  • right end position:
    • 9571
  • centisome position:
    • 67.13971
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12997&oldid=27591"