Difference between revisions of "IMIDAZOLE ACETALDEHYDE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5703 == * Synonym(s): == Reactions associated == * HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN ** in-silico_annotation ***ec-number == Path...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-GLUCURONOSYL-1-2 LUTEOLIN-7-O-BETA-D-GLUCURONOSYL-1-2] == * smiles: ** C(C6...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-GLUCURONOSYL-1-2 LUTEOLIN-7-O-BETA-D-GLUCURONOSYL-1-2] == |
| + | * smiles: | ||
| + | ** C(C6(OC(OC5(=CC=C(C1(OC4(C(C(C=1)=O)=C(C=C(OC2(C(C(C(C(C([O-])=O)O2)O)O)OC3(OC(C(C(C3O)O)O)C([O-])=O)))C=4)O)))C=C5O))C(C(C6O)O)O))(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=AEYXZGCDWDUIKX-OFFAAIFBSA-K | ||
| + | * common name: | ||
| + | ** luteolin 7-O-[β-D-glucosyluronate-(1,2)-β-D-glucosiduronate]-4'-O-β-D-glucosiduronate | ||
| + | * molecular weight: | ||
| + | ** 811.593 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]-4'-O-β-D-glucuronide | ||
| + | ** luteolin triglucuronide | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-15289]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878438 46878438] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58678 58678] | ||
| + | * HMDB : HMDB60296 | ||
| + | {{#set: smiles=C(C6(OC(OC5(=CC=C(C1(OC4(C(C(C=1)=O)=C(C=C(OC2(C(C(C(C(C([O-])=O)O2)O)O)OC3(OC(C(C(C3O)O)O)C([O-])=O)))C=4)O)))C=C5O))C(C(C6O)O)O))(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=AEYXZGCDWDUIKX-OFFAAIFBSA-K}} | ||
| + | {{#set: common name=luteolin 7-O-[β-D-glucosyluronate-(1,2)-β-D-glucosiduronate]-4'-O-β-D-glucosiduronate}} | ||
| + | {{#set: molecular weight=811.593 }} | ||
| + | {{#set: common name=luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]-4'-O-β-D-glucuronide|luteolin triglucuronide}} | ||
| + | {{#set: consumed by=RXN-15289}} | ||
Revision as of 18:53, 18 March 2018
Contents
Metabolite LUTEOLIN-7-O-BETA-D-GLUCURONOSYL-1-2
- smiles:
- C(C6(OC(OC5(=CC=C(C1(OC4(C(C(C=1)=O)=C(C=C(OC2(C(C(C(C(C([O-])=O)O2)O)O)OC3(OC(C(C(C3O)O)O)C([O-])=O)))C=4)O)))C=C5O))C(C(C6O)O)O))(=O)[O-]
- inchi key:
- InChIKey=AEYXZGCDWDUIKX-OFFAAIFBSA-K
- common name:
- luteolin 7-O-[β-D-glucosyluronate-(1,2)-β-D-glucosiduronate]-4'-O-β-D-glucosiduronate
- molecular weight:
- 811.593
- Synonym(s):
- luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]-4'-O-β-D-glucuronide
- luteolin triglucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C6(OC(OC5(=CC=C(C1(OC4(C(C(C=1)=O)=C(C=C(OC2(C(C(C(C(C([O-])=O)O2)O)O)OC3(OC(C(C(C3O)O)O)C([O-])=O)))C=4)O)))C=C5O))C(C(C6O)O)O))(=O)[O-" cannot be used as a page name in this wiki.
"luteolin 7-O-[β-D-glucosyluronate-(1,2)-β-D-glucosiduronate]-4'-O-β-D-glucosiduronate" cannot be used as a page name in this wiki.
"luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]-4'-O-β-D-glucuronide" cannot be used as a page name in this wiki.
