Difference between revisions of "GLYCOLATEMET-PWY"

Revision as of 16:00, 10 January 2018

"C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_9249 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] ==
+* smiles:
+** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)
+* inchi key:
+** InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M
+* common name:
+** 2-carboxy-L-xylonolactone
+* molecular weight:
+** 191.117
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[2.7.1.68-RXN]]
+* [[RXN-12871]]
-** [[pantograph]]-[[athaliana]]
+== Reaction(s) known to produce the compound ==
-== Pathways associated ==
+* [[RXN-12870]]
-* [[PWY-6352]]
+== Reaction(s) of unknown directionality ==
-* [[PWY-6351]]
 == External links  ==
-{{#set: reaction associated=2.7.1.68-RXN}}
+* PUBCHEM:
-{{#set: pathway associated=PWY-6352|PWY-6351}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658445 90658445]
+{{#set: smiles=C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)}}
+{{#set: inchi key=InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M}}
+{{#set: common name=2-carboxy-L-xylonolactone}}
+{{#set: molecular weight=191.117    }}
+{{#set: consumed by=RXN-12871}}
+{{#set: produced by=RXN-12870}}