Difference between revisions of "GLYCOLATEMET-PWY"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9249 == * Synonym(s): == Reactions associated == * 2.7.1.68-RXN ** pantograph-athaliana == Pathways associated == * PWY-6352...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == |
+ | * smiles: | ||
+ | ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** 2-carboxy-L-xylonolactone | ||
+ | * molecular weight: | ||
+ | ** 191.117 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-12871]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-12870]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658445 90658445] |
+ | {{#set: smiles=C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)}} | ||
+ | {{#set: inchi key=InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=2-carboxy-L-xylonolactone}} | ||
+ | {{#set: molecular weight=191.117 }} | ||
+ | {{#set: consumed by=RXN-12871}} | ||
+ | {{#set: produced by=RXN-12870}} |
Revision as of 17:00, 10 January 2018
Contents
Metabolite CPD-13913
- smiles:
- C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)
- inchi key:
- InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M
- common name:
- 2-carboxy-L-xylonolactone
- molecular weight:
- 191.117
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)" cannot be used as a page name in this wiki.