|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HYDROG-RXN HYDROG-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| + | * inchi key: |
| + | ** InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J |
| * common name: | | * common name: |
− | ** cytosolic_fe-s_cluster_assembly_factor_narfl | + | ** 6-cis-tridecenoyl-CoA |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/1.12.7.2 EC-1.12.7.2] | + | ** 957.819 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 6Z-tridecenoyl-CoA |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-14771]] |
− | ** 1 [[HYDROGEN-MOLECULE]][c] '''+''' 2 [[Oxidized-ferredoxins]][c] '''<=>''' 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 H2[c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c] '''<=>''' 2 H+[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_4288]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-6780]], hydrogen production VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6780 PWY-6780]
| + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | * [[GLUDEG-II-PWY]], L-glutamate degradation VII (to butanoate): [http://metacyc.org/META/NEW-IMAGE?object=GLUDEG-II-PWY GLUDEG-II-PWY]
| + | |
− | ** '''2''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-6785]], hydrogen production VIII: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6785 PWY-6785]
| + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
− | * [[PWY-6759]], hydrogen production III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6759 PWY-6759]
| + | |
− | ** '''1''' reactions found over '''1''' reactions in the full pathway
| + | |
− | * [[PWY4LZ-257]], superpathway of fermentation (Chlamydomonas reinhardtii): [http://metacyc.org/META/NEW-IMAGE?object=PWY4LZ-257 PWY4LZ-257]
| + | |
− | ** '''5''' reactions found over '''13''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00019 R00019] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659199 90659199] |
− | * UNIPROT:
| + | {{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | ** [http://www.uniprot.org/uniprot/P27648 P27648]
| + | {{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J}} |
− | ** [http://www.uniprot.org/uniprot/P31892 P31892]
| + | {{#set: common name=6-cis-tridecenoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/O25350 O25350]
| + | {{#set: molecular weight=957.819 }} |
− | ** [http://www.uniprot.org/uniprot/O67092 O67092]
| + | {{#set: common name=6Z-tridecenoyl-CoA}} |
− | ** [http://www.uniprot.org/uniprot/P31891 P31891]
| + | {{#set: consumed by=RXN-14771}} |
− | ** [http://www.uniprot.org/uniprot/P0AAJ8 P0AAJ8]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66894 O66894]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0AAM1 P0AAM1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31898 P31898]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0ACE0 P0ACE0]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28891 O28891]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66895 O66895]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZLK4 Q9ZLK4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WY44 Q9WY44]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q46508 Q46508]
| + | |
− | ** [http://www.uniprot.org/uniprot/O66896 O66896]
| + | |
− | ** [http://www.uniprot.org/uniprot/O67095 O67095]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PN32 Q9PN32]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13061 P13061]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UYN3 Q9UYN3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16429 P16429]
| + | |
− | ** [http://www.uniprot.org/uniprot/O52683 O52683]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13066 P13066]
| + | |
− | ** [http://www.uniprot.org/uniprot/O25349 O25349]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0AAK1 P0AAK1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29166 P29166]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07603 P07603]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13628 P13628]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0ACD8 P0ACD8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69739 P69739]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12636 P12636]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12635 P12635]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59262 Q59262]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33375 P33375]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33374 P33374]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21950 P21950]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21949 P21949]
| + | |
− | ** [http://www.uniprot.org/uniprot/P23000 P23000]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M121 Q7M121]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15283 P15283]
| + | |
− | ** [http://www.uniprot.org/uniprot/P15284 P15284]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16430 P16430]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16431 P16431]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16432 P16432]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16433 P16433]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17633 P17633]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17632 P17632]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18191 P18191]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18637 P18637]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18636 P18636]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q46606 Q46606]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31875 P31875]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0Y1 Q7M0Y1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M0Y0 Q7M0Y0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S8S0 Q9S8S0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31883 P31883]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21960 P21960]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43953 Q43953]
| + | |
− | ** [http://www.uniprot.org/uniprot/O96948 O96948]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=cytosolic_fe-s_cluster_assembly_factor_narfl}}
| + | |
− | {{#set: ec number=EC-1.12.7.2}}
| + | |
− | {{#set: gene associated=Tiso_gene_4288}}
| + | |
− | {{#set: in pathway=PWY-6780|GLUDEG-II-PWY|PWY-6785|PWY-6759|PWY4LZ-257}}
| + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}}
| + | |
− | {{#set: reconstruction source=esiliculosus}} | + | |
− | {{#set: reconstruction category=annotation}} | + | |
− | {{#set: reconstruction tool=pathwaytools}} | + | |
− | {{#set: reconstruction source=in-silico_annotation}} | + | |