Difference between revisions of "Uracil-54-in-tRNA"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12514 == * Synonym(s): == Reactions associated == * DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN ** pantograph-athaliana ** pantograph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == * smiles: ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) * inchi key: ** InChIKey=AAW...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == |
+ | * smiles: | ||
+ | ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M | ||
+ | * common name: | ||
+ | ** L-quinate | ||
+ | * molecular weight: | ||
+ | ** 191.16 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (-)-quinic acid | ||
+ | ** (-)-quinate | ||
+ | ** (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[QUINATE-5-DEHYDROGENASE-RXN]] |
− | + | * [[RXN-7967]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 77-95-2 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1560034 1560034] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.1272058.html 1272058] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29751 29751] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00296 C00296] | ||
+ | {{#set: smiles=C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)}} | ||
+ | {{#set: inchi key=InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M}} | ||
+ | {{#set: common name=L-quinate}} | ||
+ | {{#set: molecular weight=191.16 }} | ||
+ | {{#set: common name=(-)-quinic acid|(-)-quinate|(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate}} | ||
+ | {{#set: consumed by=QUINATE-5-DEHYDROGENASE-RXN|RXN-7967}} |
Revision as of 18:54, 18 March 2018
Contents
Metabolite QUINATE
- smiles:
- C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)
- inchi key:
- InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M
- common name:
- L-quinate
- molecular weight:
- 191.16
- Synonym(s):
- (-)-quinic acid
- (-)-quinate
- (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1)" cannot be used as a page name in this wiki.