Difference between revisions of "Tiso gene 14030"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN] == * direction: ** LEFT-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11528 CPD-11528] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11528 CPD-11528] == |
− | * | + | * smiles: |
− | ** | + | ** CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4) |
+ | * inchi key: | ||
+ | ** InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** OPC4-3-ketoacyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 997.797 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-10701]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10703]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237346 44237346] |
− | + | {{#set: smiles=CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}} | |
− | + | {{#set: inchi key=InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J}} | |
− | + | {{#set: common name=OPC4-3-ketoacyl-CoA}} | |
− | + | {{#set: molecular weight=997.797 }} | |
− | + | {{#set: consumed by=RXN-10701}} | |
− | + | {{#set: produced by=RXN-10703}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 19:55, 18 March 2018
Contents
Metabolite CPD-11528
- smiles:
- CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
- inchi key:
- InChIKey=QGJLCXXJEFRWHP-BUMUVWNNSA-J
- common name:
- OPC4-3-ketoacyl-CoA
- molecular weight:
- 997.797
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC4(C(=O)CCC(CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.