Difference between revisions of "HDS"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * smiles: ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == |
* smiles: | * smiles: | ||
− | ** C | + | ** CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N |
* common name: | * common name: | ||
− | ** | + | ** apo-4'-lycopenal |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 482.748 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-11999]] | |
− | * [[RXN- | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986183 50986183] |
− | + | {{#set: smiles=CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O}} | |
− | + | {{#set: inchi key=InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N}} | |
− | + | {{#set: common name=apo-4'-lycopenal}} | |
− | + | {{#set: molecular weight=482.748 }} | |
− | + | {{#set: produced by=RXN-11999}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: smiles=C( | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | + | ||
− | + | ||
− | {{#set: produced by= | + | |
− | + |
Revision as of 18:55, 18 March 2018
Contents
Metabolite CPD-12936
- smiles:
- CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=O
- inchi key:
- InChIKey=QPKNTQUMMSIKLQ-YMWARTTESA-N
- common name:
- apo-4'-lycopenal
- molecular weight:
- 482.748
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: