Difference between revisions of "Tiso gene 2897"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptides-holder Peptides-holder] == * common name: ** a peptide * Synonym(s): ** peptide == Re...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Peptides-holder Peptides-holder] ==
−
* smiles:
+
−
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C
+
−
* inchi key:
+
−
** InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K
+
 
* common name:
 
* common name:
−
** N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate
+
** a peptide
−
* molecular weight:
+
−
** 572.278   
+
 
* Synonym(s):
 
* Synonym(s):
−
** iPTP
+
** peptide
−
** isopentenyladenosine riboside-5'-triphosphate
+
−
** iPRTP
+
−
** isopentenyladenosine-5'-triphosphate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.4.11.9-RXN]]
 +
* [[3.4.16.5-RXN]]
 +
* [[3.4.11.14-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-4303]]
+
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
 +
* [[3.4.25.1-RXN]]
 +
* [[3.4.24.70-RXN]]
 +
* [[RXN0-3201]]
 +
* [[3.4.11.18-RXN]]
 +
* [[3.4.23.1-RXN]]
 +
* [[3.4.21.4-RXN]]
 +
* [[3.4.22.15-RXN]]
 +
* [[3.4.24.64-RXN]]
 +
* [[3.4.21.50-RXN]]
 +
* [[3.4.11.14-RXN]]
 +
* [[3.4.21.102-RXN]]
 +
* [[3.4.14.9-RXN]]
 +
* [[3.4.11.5-RXN]]
 +
* [[3.4.21.89-RXN]]
 +
* [[3.4.21.53-RXN]]
 +
* [[3.4.11.21-RXN]]
 +
* [[3.4.21.112-RXN]]
 +
* [[3.4.21.92-RXN]]
 +
* [[3.4.11.9-RXN]]
 +
* [[ACYLAMINOACYL-PEPTIDASE-RXN]]
 +
* [[3.4.21.83-RXN]]
 +
* [[3.4.24.11-RXN]]
 +
* [[3.4.24.71-RXN]]
 +
* [[3.4.21.107-RXN]]
 +
* [[3.4.16.5-RXN]]
 +
* [[3.4.22.1-RXN]]
 +
* [[3.4.22.34-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a peptide}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203647 25203647]
+
{{#set: common name=peptide}}
−
* CHEBI:
+
{{#set: consumed by=3.4.11.9-RXN|3.4.16.5-RXN|3.4.11.14-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71679 71679]
+
{{#set: produced by=GAMMA-GLUTAMYLTRANSFERASE-RXN|3.4.25.1-RXN|3.4.24.70-RXN|RXN0-3201|3.4.11.18-RXN|3.4.23.1-RXN|3.4.21.4-RXN|3.4.22.15-RXN|3.4.24.64-RXN|3.4.21.50-RXN|3.4.11.14-RXN|3.4.21.102-RXN|3.4.14.9-RXN|3.4.11.5-RXN|3.4.21.89-RXN|3.4.21.53-RXN|3.4.11.21-RXN|3.4.21.112-RXN|3.4.21.92-RXN|3.4.11.9-RXN|ACYLAMINOACYL-PEPTIDASE-RXN|3.4.21.83-RXN|3.4.24.11-RXN|3.4.24.71-RXN|3.4.21.107-RXN|3.4.16.5-RXN|3.4.22.1-RXN|3.4.22.34-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C16424 C16424]
+
−
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C}}
+
−
{{#set: inchi key=InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K}}
+
−
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate}}
+
−
{{#set: molecular weight=572.278    }}
+
−
{{#set: common name=iPTP|isopentenyladenosine riboside-5'-triphosphate|iPRTP|isopentenyladenosine-5'-triphosphate}}
+
−
{{#set: produced by=RXN-4303}}
+

Revision as of 18:55, 18 March 2018

Metabolite Peptides-holder

  • common name:
    • a peptide
  • Synonym(s):
    • peptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2897&oldid=27835"