Difference between revisions of "Tiso gene 17498"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYAMPP PYAMPP] == * direction: ** LEFT-TO-RIGHT * common name: ** Pyridoxamine-5'-phosphate phospho...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * smiles: ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O * inchi key: ** InCh...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYAMPP PYAMPP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
 +
* inchi key:
 +
** InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
 
* common name:
 
* common name:
−
** Pyridoxamine-5'-phosphate phosphohydrolase
+
** aldehydo-D-ribose 5-phosphate
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** keto-D-ribose 5-phosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[WATER]][c] '''+''' 1.0 [[PYRIDOXAMINE-5P]][c] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[PYRIDOXAMINE]][c]
+
* [[RXN-15346]]
−
* With common name(s):
+
* [[RXN-14997]]
−
** 1.0 H2O[c] '''+''' 1.0 pyridoxamine 5'-phosphate[c] '''=>''' 1.0 phosphate[c] '''+''' 1.0 pyridoxamine[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_18054]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Pyridoxamine-5'-phosphate phosphohydrolase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21115541 21115541]
−
{{#set: gene associated=Tiso_gene_18054}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58273 58273]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=[CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L}}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=aldehydo-D-ribose 5-phosphate}}
 +
{{#set: molecular weight=228.095    }}
 +
{{#set: common name=keto-D-ribose 5-phosphate}}
 +
{{#set: produced by=RXN-15346|RXN-14997}}

Revision as of 18:56, 18 March 2018

Metabolite CPD-15895

  • smiles:
    • [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
  • inchi key:
    • InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
  • common name:
    • aldehydo-D-ribose 5-phosphate
  • molecular weight:
    • 228.095
  • Synonym(s):
    • keto-D-ribose 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17498&oldid=27846"