Difference between revisions of "Beta-D-glucan-w-C-3-substitution"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AGMATIN-RXN AGMATIN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-]...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AGMATIN-RXN AGMATIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7090 CPD-7090] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.5.3.11 EC-3.5.3.11]
+
** InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M
 +
* common name:
 +
** delphinidin
 +
* molecular weight:
 +
** 301.232   
 
* Synonym(s):
 
* Synonym(s):
 +
** delfinidin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-9723]]
−
** 1 [[WATER]][c] '''+''' 1 [[AGMATHINE]][c] '''=>''' 1 [[UREA]][c] '''+''' 1 [[PUTRESCINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-7785]]
−
** 1 H2O[c] '''+''' 1 agmatine[c] '''=>''' 1 urea[c] '''+''' 1 putrescine[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_4415]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6305]], putrescine biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6305 PWY-6305]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY0-823]], L-arginine degradation III (arginine decarboxylase/agmatinase pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-823 PWY0-823]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-40]], putrescine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-40 PWY-40]
+
−
** '''1''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13929 13929]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203213 25203213]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01157 R01157]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28436 28436]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P60654 P60654]
+
** [http://www.genome.jp/dbget-bin/www_bget?C05908 C05908]
−
** [http://www.uniprot.org/uniprot/P60653 P60653]
+
* HMDB : HMDB03074
−
** [http://www.uniprot.org/uniprot/P60651 P60651]
+
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))}}
−
** [http://www.uniprot.org/uniprot/Q57757 Q57757]
+
{{#set: inchi key=InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M}}
−
** [http://www.uniprot.org/uniprot/P73270 P73270]
+
{{#set: common name=delphinidin}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: molecular weight=301.232    }}
−
{{#set: ec number=EC-3.5.3.11}}
+
{{#set: common name=delfinidin}}
−
{{#set: gene associated=Tiso_gene_4415}}
+
{{#set: consumed by=RXN-9723}}
−
{{#set: in pathway=PWY-6305|PWY0-823|PWY-40}}
+
{{#set: produced by=RXN-7785}}
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=esiliculosus}}
+

Revision as of 18:56, 18 March 2018

Metabolite CPD-7090

  • smiles:
    • C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))
  • inchi key:
    • InChIKey=JKHRCGUTYDNCLE-UHFFFAOYSA-M
  • common name:
    • delphinidin
  • molecular weight:
    • 301.232
  • Synonym(s):
    • delfinidin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C(O)=C(O)C(O)=CC=1C2(C([O-])=CC3(=C([O+]=2)C=C(O)C=C([O-])3)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Beta-D-glucan-w-C-3-substitution&oldid=27886"