Difference between revisions of "CPDQT-30"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * inchi key: ** InChIKey=AWU...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-29-3-hydroxyC48-2-ACPs cis-cis-D11-29-3-hydroxyC48-2-ACPs] == * common name: ** a c...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-29-3-hydroxyC48-2-ACPs cis-cis-D11-29-3-hydroxyC48-2-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a cis,cis-delta11,29-3-hydroxy C48:2-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a cis,cis-delta 11,29-3-hydroxy C48:2-[acyl-carrier-protein] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN1G-853]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a cis,cis-delta11,29-3-hydroxy C48:2-[acp]}} | |
| − | + | {{#set: common name=a cis,cis-delta 11,29-3-hydroxy C48:2-[acyl-carrier-protein]}} | |
| − | + | {{#set: produced by=RXN1G-853}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: produced by= | + | |
| − | + | ||
Revision as of 18:56, 18 March 2018
Contents
Metabolite cis-cis-D11-29-3-hydroxyC48-2-ACPs
- common name:
- a cis,cis-delta11,29-3-hydroxy C48:2-[acp]
- Synonym(s):
- a cis,cis-delta 11,29-3-hydroxy C48:2-[acyl-carrier-protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a cis,cis-delta11,29-3-hydroxy C48:2-[acp" cannot be used as a page name in this wiki.
"a cis,cis-delta 11,29-3-hydroxy C48:2-[acyl-carrier-protein" cannot be used as a page name in this wiki.
