Difference between revisions of "4-HYDROXY-2-KETOPIMELATE-LYSIS-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_475 == * left end position: ** 28848 * transcription direction: ** NEGATIVE * right end position: ** 30897 * centisome position: ** 87.6465...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4124 CPD-4124] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4124 CPD-4124] == |
− | * | + | * smiles: |
− | ** | + | ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34)))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N |
− | * | + | * common name: |
− | ** | + | ** 24-ethylidenelophenol |
− | * | + | * molecular weight: |
− | ** | + | ** 426.724 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (Z)-24-ethylidenelophenol | ||
+ | ** citrostadienol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.1.1.143-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548595 9548595] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33203 33203] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11523 C11523] |
+ | {{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: inchi key=InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N}} | ||
+ | {{#set: common name=24-ethylidenelophenol}} | ||
+ | {{#set: molecular weight=426.724 }} | ||
+ | {{#set: common name=(Z)-24-ethylidenelophenol|citrostadienol}} | ||
+ | {{#set: produced by=2.1.1.143-RXN}} |
Revision as of 18:56, 18 March 2018
Contents
Metabolite CPD-4124
- smiles:
- CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=LPZCCMIISIBREI-JXMPMKKESA-N
- common name:
- 24-ethylidenelophenol
- molecular weight:
- 426.724
- Synonym(s):
- (Z)-24-ethylidenelophenol
- citrostadienol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.