Difference between revisions of "ILE-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHFtm METHFtm] == * direction: ** REVERSIBLE * common name: ** 5,10-Methenyltetrahydrofolate upta...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * inchi key: **...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=METHFtm METHFtm] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
 +
* inchi key:
 +
** InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N
 
* common name:
 
* common name:
−
** 5,10-Methenyltetrahydrofolate uptake carrier, mitochondria
+
** 4α-hydroxy-tetrahydrobiopterin
 +
* molecular weight:
 +
** 257.249   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4α-hydroxy-5,6,7,8-tetrahydrobiopterin
 +
** 4α-hydroxy-tetrahydropterin
 +
** 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7908]]
−
** 1.0 [[5-10-METHENYL-THF]][c] '''+''' 1.0 [[PROTON]][c] '''<=>''' 1.0 [[5-10-METHENYL-THF]][m] '''+''' 1.0 [[PROTON]][m]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c] '''+''' 1.0 H+[c] '''<=>''' 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[m] '''+''' 1.0 H+[m]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_19115]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=5,10-Methenyltetrahydrofolate uptake carrier, mitochondria}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657593 90657593]
−
{{#set: gene associated=Tiso_gene_19115}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15374 15374]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15522 C15522]
−
{{#set: reconstruction source=creinhardtii}}
+
* HMDB : HMDB02281
 +
{{#set: smiles=CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))}}
 +
{{#set: inchi key=InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N}}
 +
{{#set: common name=4&alpha;-hydroxy-tetrahydrobiopterin}}
 +
{{#set: molecular weight=257.249    }}
 +
{{#set: common name=4&alpha;-hydroxy-5,6,7,8-tetrahydrobiopterin|4&alpha;-hydroxy-tetrahydropterin|6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4&alpha;-hydroxypterin}}
 +
{{#set: consumed by=RXN-7908}}

Revision as of 18:57, 18 March 2018

Metabolite CPD-5881

  • smiles:
    • CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
  • inchi key:
    • InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N
  • common name:
    • 4α-hydroxy-tetrahydrobiopterin
  • molecular weight:
    • 257.249
  • Synonym(s):
    • 4α-hydroxy-5,6,7,8-tetrahydrobiopterin
    • 4α-hydroxy-tetrahydropterin
    • 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ILE-tRNAs&oldid=27962"