Difference between revisions of "MI-HEXAKISPHOSPHATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_20557 == * Synonym(s): == Reactions associated == * GLYCINE-AMINOTRANSFERASE-RXN ** pantograph-creinhardtii == Pathways associ...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * smiles: ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) *...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_20557 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] ==
 +
* smiles:
 +
** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)
 +
* inchi key:
 +
** InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M
 +
* common name:
 +
** kaempferol
 +
* molecular weight:
 +
** 285.232   
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
+
* [[RXN-13935]]
** [[pantograph]]-[[creinhardtii]]
+
* [[RXN-12510]]
== Pathways associated ==
+
== Reaction(s) known to produce the compound ==
* [[PWY-181]]
+
* [[RXN1F-93]]
 +
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=GLYCINE-AMINOTRANSFERASE-RXN}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-181}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202062 25202062]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58573 58573]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05903 C05903]
 +
* HMDB : HMDB05801
 +
{{#set: smiles=C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)}}
 +
{{#set: inchi key=InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M}}
 +
{{#set: common name=kaempferol}}
 +
{{#set: molecular weight=285.232    }}
 +
{{#set: consumed by=RXN-13935|RXN-12510}}
 +
{{#set: produced by=RXN1F-93}}

Revision as of 18:57, 18 March 2018

Metabolite CPD1F-90

  • smiles:
    • C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)
  • inchi key:
    • InChIKey=IYRMWMYZSQPJKC-UHFFFAOYSA-M
  • common name:
    • kaempferol
  • molecular weight:
    • 285.232
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3)" cannot be used as a page name in this wiki.