Difference between revisions of "CPD-535"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8895 == * left end position: ** 296 * transcription direction: ** POSITIVE * right end position: ** 1311 * centisome position: ** 3.0250382...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_8895 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] ==
* left end position:
+
* smiles:
** 296
+
** CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=MMZJVINJFSRJOK-CYNJBPNESA-J
* right end position:
+
* common name:
** 1311
+
** (2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
* centisome position:
+
* molecular weight:
** 3.0250382    
+
** 1102.034    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
+
* [[RXN-16131]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN-16130]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-11201]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=296}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551529 72551529]
{{#set: right end position=1311}}
+
* CHEBI:
{{#set: centisome position=3.0250382   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76464 76464]
{{#set: reaction associated=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN|RXN-11201}}
+
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
 +
{{#set: inchi key=InChIKey=MMZJVINJFSRJOK-CYNJBPNESA-J}}
 +
{{#set: common name=(2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}}
 +
{{#set: molecular weight=1102.034   }}
 +
{{#set: consumed by=RXN-16131}}
 +
{{#set: produced by=RXN-16130}}

Revision as of 18:57, 18 March 2018

Metabolite CPD-17383

  • smiles:
    • CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • inchi key:
    • InChIKey=MMZJVINJFSRJOK-CYNJBPNESA-J
  • common name:
    • (2Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
  • molecular weight:
    • 1102.034
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.