|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ISOCITDEH-RXN ISOCITDEH-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENOSINE DEOXYADENOSINE] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(N)N=CN=C23))) |
| + | * inchi key: |
| + | ** InChIKey=OLXZPDWKRNYJJZ-RRKCRQDMSA-N |
| * common name: | | * common name: |
− | ** ORF | + | ** 2'-deoxyadenosine |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/1.1.1.42 EC-1.1.1.42] | + | ** 251.244 |
| * Synonym(s): | | * Synonym(s): |
| + | ** deoxyadenosine |
| + | ** 2-deoxy-adenosine |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[DAD2PT]] |
− | ** 1 [[NADP]][c] '''+''' 1 [[THREO-DS-ISO-CITRATE]][c] '''<=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[NADPH]][c]
| + | * [[ADDALT-RXN]] |
− | * With common name(s):
| + | == Reaction(s) known to produce the compound == |
− | ** 1 NADP+[c] '''+''' 1 D-threo-isocitrate[c] '''<=>''' 1 CO2[c] '''+''' 1 2-oxoglutarate[c] '''+''' 1 NADPH[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | * [[DAMPH]] |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_10809]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_18262]] | + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913]
| + | |
− | ** '''9''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-6549]], L-glutamine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6549 PWY-6549]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7268]], NAD/NADP-NADH/NADPH cytosolic interconversion (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7268 PWY-7268]
| + | |
− | ** '''4''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[TCA]], TCA cycle I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=TCA TCA]
| + | |
− | ** '''7''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[P23-PWY]], reductive TCA cycle I: [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY]
| + | |
− | ** '''7''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[P105-PWY]], TCA cycle IV (2-oxoglutarate decarboxylase): [http://metacyc.org/META/NEW-IMAGE?object=P105-PWY P105-PWY]
| + | |
− | ** '''9''' reactions found over '''11''' reactions in the full pathway
| + | |
− | * [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
| + | |
− | ** '''9''' reactions found over '''12''' reactions in the full pathway
| + | |
− | * [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728] | + | |
− | ** '''11''' reactions found over '''18''' reactions in the full pathway
| + | |
− | * [[REDCITCYC]], TCA cycle VIII (helicobacter): [http://metacyc.org/META/NEW-IMAGE?object=REDCITCYC REDCITCYC]
| + | |
− | ** '''6''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7254]], TCA cycle VII (acetate-producers): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7254 PWY-7254]
| + | |
− | ** '''5''' reactions found over '''9''' reactions in the full pathway
| + | |
− | * [[PWY-7124]], ethylene biosynthesis V (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7124 PWY-7124]
| + | |
− | ** '''7''' reactions found over '''10''' reactions in the full pathway
| + | |
− | * [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
| + | |
− | ** '''9''' reactions found over '''16''' reactions in the full pathway
| + | |
− | == Reconstruction information ==
| + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * LIGAND-RXN: | + | * CAS : 958-09-8 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00267 R00267]
| + | * METABOLIGHTS : MTBLC17256 |
− | * PIR:
| + | * PUBCHEM: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A10759 A10759]
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13730 13730] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A43294 A43294] | + | * HMDB : HMDB00101 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A43934 A43934] | + | * LIGAND-CPD: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A49341 A49341] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00559 C00559] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A54756 A54756]
| + | * CHEMSPIDER: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=A55591 A55591]
| + | ** [http://www.chemspider.com/Chemical-Structure.13135.html 13135] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=B49341 B49341] | + | * CHEBI: |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C64523 C64523] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17256 17256] |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=C81399 C81399]
| + | * BIGG : dad_2 |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DCBYIS DCBYIS] | + | {{#set: smiles=C(O)C1(OC(CC(O)1)N3(C=NC2(=C(N)N=CN=C23)))}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DCECIS DCECIS] | + | {{#set: inchi key=InChIKey=OLXZPDWKRNYJJZ-RRKCRQDMSA-N}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=G69330 G69330] | + | {{#set: common name=2'-deoxyadenosine}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=H64389 H64389]
| + | {{#set: molecular weight=251.244 }} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=H81877 H81877] | + | {{#set: common name=deoxyadenosine|2-deoxy-adenosine}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=H86708 H86708] | + | {{#set: consumed by=DAD2PT|ADDALT-RXN}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40382 I40382]
| + | {{#set: reversible reaction associated=DAMPH}} |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=I40719 I40719]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=JC4600 JC4600] | + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S28423 S28423]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S33612 S33612]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S33859 S33859]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S47013 S47013]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S51419 S51419]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S57499 S57499]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S62921 S62921]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S65065 S65065]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S74684 S74684]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T04355 T04355]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T04356 T04356]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T07402 T07402]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T09619 T09619]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T39058 T39058]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T44658 T44658]
| + | |
− | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=T46280 T46280]
| + | |
− | * UNIPROT:
| + | |
− | ** [http://www.uniprot.org/uniprot/P16100 P16100]
| + | |
− | ** [http://www.uniprot.org/uniprot/P33198 P33198]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41561 P41561]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41562 P41562]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50214 P50214]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41560 P41560]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56063 P56063]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PHY3 Q9PHY3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21954 P21954]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08200 P08200]
| + | |
− | ** [http://www.uniprot.org/uniprot/O29610 O29610]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JUV7 Q9JUV7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CHQ4 Q9CHQ4]
| + | |
− | ** [http://www.uniprot.org/uniprot/P39126 P39126]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50216 P50216]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50215 P50215]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04467 Q04467]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50217 P50217]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41939 P41939]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48735 P48735]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53982 P53982]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50218 P50218]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65853 O65853]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q40345 Q40345]
| + | |
− | ** [http://www.uniprot.org/uniprot/O14254 O14254]
| + | |
− | ** [http://www.uniprot.org/uniprot/O75874 O75874]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=ORF}}
| + | |
− | {{#set: ec number=EC-1.1.1.42}}
| + | |
− | {{#set: gene associated=Tiso_gene_10809|Tiso_gene_18262}}
| + | |
− | {{#set: in pathway=PWY-5913|PWY-6549|PWY-7268|TCA|P23-PWY|P105-PWY|PWY-6969|PWY-6728|REDCITCYC|PWY-7254|PWY-7124|FERMENTATION-PWY}} | + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=esiliculosus}} | + | |
− | {{#set: reconstruction category=manual}} | + | |
− | {{#set: reconstruction source=primary_network}} | + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |