Difference between revisions of "Tiso gene 18201"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_10649 == * left end position: ** 8215 * transcription direction: ** POSITIVE * right end position: ** 8387 * centisome position: ** 97.9492...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_10649 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] ==
−
* left end position:
+
* smiles:
−
** 8215
+
** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L
−
* right end position:
+
* common name:
−
** 8387
+
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
−
* centisome position:
+
* molecular weight:
−
** 97.9492    
+
** 728.942    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.1.26.3-RXN]]
+
* [[RXN-16121]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN-16118]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=8215}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819824 91819824]
−
{{#set: right end position=8387}}
+
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O}}
−
{{#set: centisome position=97.9492   }}
+
{{#set: inchi key=InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L}}
−
{{#set: reaction associated=3.1.26.3-RXN}}
+
{{#set: common name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}}
 +
{{#set: molecular weight=728.942   }}
 +
{{#set: consumed by=RXN-16121}}
 +
{{#set: produced by=RXN-16118}}

Revision as of 18:57, 18 March 2018

Metabolite CPD-17373

  • smiles:
    • C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O
  • inchi key:
    • InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L
  • common name:
    • 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
  • molecular weight:
    • 728.942
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.
"1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18201&oldid=27987"