Difference between revisions of "Tiso gene 9833"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MI-HEXAKISPHOSPHATE MI-HEXAKISPHOSPHATE] == * smiles: ** C1(OP([O-])([O-])=O)(C(OP([O-])(=O)[O-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-leucyl-L-arginyl-Protein L-leucyl-L-arginyl-Protein] == * common name: ** a [protein] N-termi...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MI-HEXAKISPHOSPHATE MI-HEXAKISPHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-leucyl-L-arginyl-Protein L-leucyl-L-arginyl-Protein] ==
* smiles:
+
** C1(OP([O-])([O-])=O)(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP([O-])([O-])=O)1)
+
* inchi key:
+
** InChIKey=IMQLKJBTEOYOSI-GPIVLXJGSA-B
+
 
* common name:
 
* common name:
** phytate
+
** a [protein] N-terminal L-leucyl-L-arginine
* molecular weight:
+
** 647.942   
+
 
* Synonym(s):
 
* Synonym(s):
** phytic acid
+
** L-leucyl-L-arginyl-[protein]
** 1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate
+
** myo-inositol hexakisphosphate
+
** D-myo-Inositol 1,2,3,4,5,6-hexakisphosphate
+
** myo-Inositol 1,2,3,4,5,6-hexakisphosphate
+
** Inositol 1,2,3,4,5,6-hexakisphosphate
+
** InsP6
+
** 1D-myo-Inositol hexakisphosphate
+
** IP6
+
** inositol hexaphosphate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7163]]
+
* [[RXN-17846]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* METABOLIGHTS : MTBLC58130
+
{{#set: common name=a [protein] N-terminal L-leucyl-L-arginine}}
* PUBCHEM:
+
{{#set: common name=L-leucyl-L-arginyl-[protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21584050 21584050]
+
{{#set: produced by=RXN-17846}}
* HMDB : HMDB03502
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01204 C01204]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.10618952.html 10618952]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58130 58130]
+
* BIGG : minohp
+
{{#set: smiles=C1(OP([O-])([O-])=O)(C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(OP([O-])([O-])=O)1)}}
+
{{#set: inchi key=InChIKey=IMQLKJBTEOYOSI-GPIVLXJGSA-B}}
+
{{#set: common name=phytate}}
+
{{#set: molecular weight=647.942    }}
+
{{#set: common name=phytic acid|1D-myo-inositol 1,2,3,4,5,6-hexakisphosphate|myo-inositol hexakisphosphate|D-myo-Inositol 1,2,3,4,5,6-hexakisphosphate|myo-Inositol 1,2,3,4,5,6-hexakisphosphate|Inositol 1,2,3,4,5,6-hexakisphosphate|InsP6|1D-myo-Inositol hexakisphosphate|IP6|inositol hexaphosphate}}
+
{{#set: produced by=RXN-7163}}
+

Revision as of 19:57, 18 March 2018

Metabolite L-leucyl-L-arginyl-Protein

  • common name:
    • a [protein] N-terminal L-leucyl-L-arginine
  • Synonym(s):
    • L-leucyl-L-arginyl-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein] N-terminal L-leucyl-L-arginine" cannot be used as a page name in this wiki.
"L-leucyl-L-arginyl-[protein" cannot be used as a page name in this wiki.