Difference between revisions of "CPD-12932"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9657 RXN-9657] == * direction: ** LEFT-TO-RIGHT * common name: ** crotonyl-[acp] reductase * ec...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=25-DIDEHYDRO-D-GLUCONATE 25-DIDEHYDRO-D-GLUCONATE] == * smiles: ** C(C(C(C(C(C([O-])=O)=O)O)O)=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9657 RXN-9657] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=25-DIDEHYDRO-D-GLUCONATE 25-DIDEHYDRO-D-GLUCONATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C(C(C(C(C([O-])=O)=O)O)O)=O)O
 +
* inchi key:
 +
** InChIKey=RXMWXENJQAINCC-DMTCNVIQSA-M
 
* common name:
 
* common name:
−
** crotonyl-[acp] reductase
+
** 2,5-didehydro-D-gluconate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** 191.117   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2,5-diketo-D-gluconate
 +
** 2,5-diketogluconic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Crotonyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Butanoyl-ACPs]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[1.1.1.274-RXN]]
−
** 1 a crotonyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 a butyryl-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10778]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
+
−
** '''31''' reactions found over '''31''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=crotonyl-[acp] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548631 9548631]
−
{{#set: ec number=EC-1.3.1.9}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_10778}}
+
** [http://www.chemspider.com/Chemical-Structure.7827554.html 7827554]
−
{{#set: in pathway=PWY-5971}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11449 11449]
−
{{#set: reconstruction tool=pantograph}}
+
* BIGG : 25dkglcn
−
{{#set: reconstruction source=esiliculosus}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02780 C02780]
 +
{{#set: smiles=C(C(C(C(C(C([O-])=O)=O)O)O)=O)O}}
 +
{{#set: inchi key=InChIKey=RXMWXENJQAINCC-DMTCNVIQSA-M}}
 +
{{#set: common name=2,5-didehydro-D-gluconate}}
 +
{{#set: molecular weight=191.117    }}
 +
{{#set: common name=2,5-diketo-D-gluconate|2,5-diketogluconic acid}}
 +
{{#set: reversible reaction associated=1.1.1.274-RXN}}

Revision as of 18:58, 18 March 2018

Metabolite 25-DIDEHYDRO-D-GLUCONATE

  • smiles:
    • C(C(C(C(C(C([O-])=O)=O)O)O)=O)O
  • inchi key:
    • InChIKey=RXMWXENJQAINCC-DMTCNVIQSA-M
  • common name:
    • 2,5-didehydro-D-gluconate
  • molecular weight:
    • 191.117
  • Synonym(s):
    • 2,5-diketo-D-gluconate
    • 2,5-diketogluconic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(C(C(C(C([O-])=O)=O)O)O)=O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12932&oldid=28057"