Difference between revisions of "3.4.21.50-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-194 CPD-194] == * smiles: ** C1(=CC(OP([O-])(=O)[O-])=CC=C([N+]([O-])=O)1) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] == * smiles: ** C([N...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C([N+])COP([O-])(=O)OCC(O)CO[R] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 1-alkyl-sn-glycero-3-phosphoethanolamine |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine |
− | + | ** 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine | |
− | + | ** 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine | |
− | + | ||
− | ** | + | |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[LPLPS1AGPE180]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04476 C04476] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18244 18244] |
− | + | {{#set: smiles=C([N+])COP([O-])(=O)OCC(O)CO[R]}} | |
− | {{#set: smiles | + | {{#set: common name=1-alkyl-sn-glycero-3-phosphoethanolamine}} |
− | {{#set: | + | {{#set: common name=1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine|1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine|1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine}} |
− | + | {{#set: produced by=LPLPS1AGPE180}} | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 18:58, 18 March 2018
Contents
Metabolite ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE
- smiles:
- C([N+])COP([O-])(=O)OCC(O)CO[R]
- common name:
- 1-alkyl-sn-glycero-3-phosphoethanolamine
- Synonym(s):
- 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine
- 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine
- 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])COP([O-])(=O)OCC(O)CO[R" cannot be used as a page name in this wiki.