Difference between revisions of "Tiso gene 16097"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12932 CPD-12932] == * smiles: ** CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tetradec-2-enoyl-ACPs Tetradec-2-enoyl-ACPs] == * common name: ** a trans tetradec-2-enoyl-[acp...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12932 CPD-12932] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tetradec-2-enoyl-ACPs Tetradec-2-enoyl-ACPs] ==
−
* smiles:
+
−
** CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C
+
−
* inchi key:
+
−
** InChIKey=OCMSUPSDVXKDFY-FQMRBFJQSA-N
+
 
* common name:
 
* common name:
−
** all-trans-3,4-didehydrolycopene
+
** a trans tetradec-2-enoyl-[acp]
−
* molecular weight:
+
−
** 534.867   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4-dehydrolycopene
 
−
** 3,4-didehydrolycopene
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11999]]
+
* [[RXN-9662]]
 +
* [[RXN-9538]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9537]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a trans tetradec-2-enoyl-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061227 16061227]
+
{{#set: consumed by=RXN-9662|RXN-9538}}
−
* CHEMSPIDER:
+
{{#set: produced by=RXN-9537}}
−
** [http://www.chemspider.com/Chemical-Structure.17220904.html 17220904]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62474 62474]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C15867 C15867]
+
−
{{#set: smiles=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C}}
+
−
{{#set: inchi key=InChIKey=OCMSUPSDVXKDFY-FQMRBFJQSA-N}}
+
−
{{#set: common name=all-trans-3,4-didehydrolycopene}}
+
−
{{#set: molecular weight=534.867    }}
+
−
{{#set: common name=3,4-dehydrolycopene|3,4-didehydrolycopene}}
+
−
{{#set: consumed by=RXN-11999}}
+

Revision as of 18:58, 18 March 2018

Metabolite Tetradec-2-enoyl-ACPs

  • common name:
    • a trans tetradec-2-enoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a trans tetradec-2-enoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16097&oldid=28101"