Difference between revisions of "Trans-D2-cis-D15-gheddoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_856 == * left end position: ** 8865 * transcription direction: ** NEGATIVE * right end position: ** 10740 * centisome position: ** 31.42725...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] == * smiles: ** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_856 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] ==
−
* left end position:
+
* smiles:
−
** 8865
+
** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L
−
* right end position:
+
* common name:
−
** 10740
+
** mycophenolic acid phenolic glucuronide
−
* centisome position:
+
* molecular weight:
−
** 31.427256    
+
** 494.451    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** experimental_annotation
+
* [[RXN-13608]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=8865}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657160 90657160]
−
{{#set: right end position=10740}}
+
{{#set: smiles=CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)}}
−
{{#set: centisome position=31.427256   }}
+
{{#set: inchi key=InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L}}
−
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
+
{{#set: common name=mycophenolic acid phenolic glucuronide}}
 +
{{#set: molecular weight=494.451   }}
 +
{{#set: produced by=RXN-13608}}

Revision as of 18:59, 18 March 2018

Metabolite CPD-14604

  • smiles:
    • CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)
  • inchi key:
    • InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L
  • common name:
    • mycophenolic acid phenolic glucuronide
  • molecular weight:
    • 494.451
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Trans-D2-cis-D15-gheddoyl-ACPs&oldid=28114"