Difference between revisions of "TREHALA-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_15594 == * Synonym(s): == Reactions associated == * 1.14.11.2-RXN ** pantograph-esiliculosus * RXN490-3641 ** pantograph...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * inchi key: ** In...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_15594 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
 +
* smiles:
 +
** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
 +
* inchi key:
 +
** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
 +
* common name:
 +
** serotonin O-sulfate
 +
* molecular weight:
 +
** 256.276   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxytryptamine O-sulfate
 +
** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
 +
** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[1.14.11.2-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-10777]]
* [[RXN490-3641]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[esiliculosus]]
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=1.14.11.2-RXN|RXN490-3641}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.134104.html 134104]
 +
{{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}}
 +
{{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}}
 +
{{#set: common name=serotonin O-sulfate}}
 +
{{#set: molecular weight=256.276    }}
 +
{{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}}
 +
{{#set: produced by=RXN-10777}}

Revision as of 18:59, 18 March 2018

Metabolite CPD-11665

  • smiles:
    • C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
  • inchi key:
    • InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
  • common name:
    • serotonin O-sulfate
  • molecular weight:
    • 256.276
  • Synonym(s):
    • 5-hydroxytryptamine O-sulfate
    • 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
    • 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links