Difference between revisions of "CPD-12936"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_17381 == * Synonym(s): == Reactions associated == * 1.18.1.2-RXN ** pantograph-esiliculosus * RXN-17897 ** pantograph-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4081 CPD-4081] == |
+ | * smiles: | ||
+ | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N | ||
+ | * common name: | ||
+ | ** 4α-methyl-5α-ergosta-8,24-dien-3β-ol | ||
+ | * molecular weight: | ||
+ | ** 412.698 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol | ||
+ | ** 4α-methyl-5α-ergosta-8,24-dien-3β-ol | ||
+ | ** 4α-methylfecosterol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-4144]] | |
− | * [[RXN- | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=193524 193524] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80094 80094] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15776 C15776] | ||
+ | * HMDB : HMDB06845 | ||
+ | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} | ||
+ | {{#set: inchi key=InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N}} | ||
+ | {{#set: common name=4α-methyl-5α-ergosta-8,24-dien-3β-ol}} | ||
+ | {{#set: molecular weight=412.698 }} | ||
+ | {{#set: common name=4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol|4α-methyl-5α-ergosta-8,24-dien-3β-ol|4α-methylfecosterol}} | ||
+ | {{#set: produced by=RXN-4144}} |
Revision as of 18:59, 18 March 2018
Contents
Metabolite CPD-4081
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- inchi key:
- InChIKey=QLDNWJOJCDIMKK-XLFBYWHPSA-N
- common name:
- 4α-methyl-5α-ergosta-8,24-dien-3β-ol
- molecular weight:
- 412.698
- Synonym(s):
- 4α-methyl-5α-ergosta-8,14,24(28)-dien-3β-ol
- 4α-methyl-5α-ergosta-8,24-dien-3β-ol
- 4α-methylfecosterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.