Difference between revisions of "CPD1F-137"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_11824 == * left end position: ** 3821 * transcription direction: ** NEGATIVE * right end position: ** 6117 * centisome position: ** 50.9942...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * smiles: ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_11824 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] ==
* left end position:
+
* smiles:
** 3821
+
** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
* transcription direction:
+
* inchi key:
** NEGATIVE
+
** InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L
* right end position:
+
* common name:
** 6117
+
** 3-(7'-methylthio)heptylmalate
* centisome position:
+
* molecular weight:
** 50.99426    
+
** 276.347    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-(7'-methylthio)heptylmalic acid
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
+
* [[RXNQT-4178]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[RXN-18200]]
* [[TRIGLSYN-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3821}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237172 44237172]
{{#set: right end position=6117}}
+
{{#set: smiles=CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
{{#set: centisome position=50.99426   }}
+
{{#set: inchi key=InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L}}
{{#set: reaction associated=DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN}}
+
{{#set: common name=3-(7'-methylthio)heptylmalate}}
{{#set: pathway associated=TRIGLSYN-PWY}}
+
{{#set: molecular weight=276.347   }}
 +
{{#set: common name=3-(7'-methylthio)heptylmalic acid}}
 +
{{#set: consumed by=RXNQT-4178}}
 +
{{#set: reversible reaction associated=RXN-18200}}

Revision as of 18:59, 18 March 2018

Metabolite CPDQT-40

  • smiles:
    • CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
  • inchi key:
    • InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L
  • common name:
    • 3-(7'-methylthio)heptylmalate
  • molecular weight:
    • 276.347
  • Synonym(s):
    • 3-(7'-methylthio)heptylmalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.