Difference between revisions of "Tiso gene 18270"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALDOSE-1-EPIMERASE-RXN ALDOSE-1-EPIMERASE-RXN] == * direction: ** REVERSIBLE * common name: ** aldo...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * inchi key: ** InChIKey=HNDVDQJCIGZPNO-Y...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == |
− | * | + | * smiles: |
− | ** | + | ** C1(NC=NC=1CC(C(=O)[O-])[N+]) |
+ | * inchi key: | ||
+ | ** InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** L-histidine |
− | * | + | * molecular weight: |
− | ** | + | ** 155.156 |
* Synonym(s): | * Synonym(s): | ||
+ | ** glyoxaline-5-alanine | ||
+ | ** α-amino-4-imidazoleproprionic acid | ||
+ | ** (S)-α-amino-1H-imidazole-4-propanoic acid | ||
+ | ** H | ||
+ | ** histidine | ||
+ | ** his | ||
+ | ** L-his | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RME144]] | |
− | + | * [[HISTIDINE--TRNA-LIGASE-RXN]] | |
− | + | * [[CARNOSINE-SYNTHASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-8001]] | |
− | = | + | * [[HISTALDEHYD-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | * | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 71-00-1 |
− | ** [http:// | + | * METABOLIGHTS : MTBLC57595 |
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971009 6971009] |
− | * | + | * HMDB : HMDB00177 |
− | ** [http://www. | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00135 C00135] | |
− | + | * CHEBI: | |
− | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57595 57595] |
− | + | * BIGG : his__L | |
− | + | {{#set: smiles=C1(NC=NC=1CC(C(=O)[O-])[N+])}} | |
− | + | {{#set: inchi key=InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N}} | |
− | + | {{#set: common name=L-histidine}} | |
− | + | {{#set: molecular weight=155.156 }} | |
− | + | {{#set: common name=glyoxaline-5-alanine|α-amino-4-imidazoleproprionic acid|(S)-α-amino-1H-imidazole-4-propanoic acid|H|histidine|his|L-his}} | |
− | + | {{#set: consumed by=RME144|HISTIDINE--TRNA-LIGASE-RXN|CARNOSINE-SYNTHASE-RXN}} | |
− | {{#set: | + | {{#set: produced by=RXN-8001|HISTALDEHYD-RXN}} |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 20:00, 18 March 2018
Contents
Metabolite HIS
- smiles:
- C1(NC=NC=1CC(C(=O)[O-])[N+])
- inchi key:
- InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N
- common name:
- L-histidine
- molecular weight:
- 155.156
- Synonym(s):
- glyoxaline-5-alanine
- α-amino-4-imidazoleproprionic acid
- (S)-α-amino-1H-imidazole-4-propanoic acid
- H
- histidine
- his
- L-his
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 71-00-1
- METABOLIGHTS : MTBLC57595
- PUBCHEM:
- HMDB : HMDB00177
- LIGAND-CPD:
- CHEBI:
- BIGG : his__L
"C1(NC=NC=1CC(C(=O)[O-])[N+])" cannot be used as a page name in this wiki.