Difference between revisions of "Tiso gene 1404"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4568 CPD-4568] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(CO)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-O-SINAPOYL-BETA-D-GLUCOSE 1-O-SINAPOYL-BETA-D-GLUCOSE] == * smiles: ** COC2(=CC(C=CC(=O)OC1(C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-O-SINAPOYL-BETA-D-GLUCOSE 1-O-SINAPOYL-BETA-D-GLUCOSE] == |
* smiles: | * smiles: | ||
− | ** CC(C | + | ** COC2(=CC(C=CC(=O)OC1(C(O)C(C(C(O1)CO)O)O))=CC(=C(O)2)OC) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=XRKBRPFTFKKHEF-DGDBGZAXSA-N |
* common name: | * common name: | ||
− | ** | + | ** 1-O-sinapoyl-β-D-glucose |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 386.355 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 1-O-sinapoyl β-D-glucoside |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.3.1.91-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280406 5280406] |
− | {{#set: smiles=CC(C | + | * CHEMSPIDER: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.chemspider.com/Chemical-Structure.4444086.html 4444086] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16546 16546] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC16546 |
− | {{#set: consumed by= | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01175 C01175] | |
+ | {{#set: smiles=COC2(=CC(C=CC(=O)OC1(C(O)C(C(C(O1)CO)O)O))=CC(=C(O)2)OC)}} | ||
+ | {{#set: inchi key=InChIKey=XRKBRPFTFKKHEF-DGDBGZAXSA-N}} | ||
+ | {{#set: common name=1-O-sinapoyl-β-D-glucose}} | ||
+ | {{#set: molecular weight=386.355 }} | ||
+ | {{#set: common name=1-O-sinapoyl β-D-glucoside}} | ||
+ | {{#set: consumed by=2.3.1.91-RXN}} |
Revision as of 19:00, 18 March 2018
Contents
Metabolite 1-O-SINAPOYL-BETA-D-GLUCOSE
- smiles:
- COC2(=CC(C=CC(=O)OC1(C(O)C(C(C(O1)CO)O)O))=CC(=C(O)2)OC)
- inchi key:
- InChIKey=XRKBRPFTFKKHEF-DGDBGZAXSA-N
- common name:
- 1-O-sinapoyl-β-D-glucose
- molecular weight:
- 386.355
- Synonym(s):
- 1-O-sinapoyl β-D-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links