Difference between revisions of "R344-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C5 C5] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == * smiles: ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) * inchi key: ** InChIKey=JKTYG...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** 4-nitrobenzyl alcohol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 153.137 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4NBA |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-5141]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CAS : 619-73-8 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69275 69275] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.13585105.html 13585105] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=41214 41214] |
− | * | + | * NCI: |
− | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5389 5389] | |
− | ** [http:// | + | {{#set: smiles=C(O)C1(C=CC(=CC=1)[N+]([O-])=O)}} |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=4-nitrobenzyl alcohol}} |
− | {{#set: common name= | + | {{#set: molecular weight=153.137 }} |
− | {{#set: molecular weight= | + | {{#set: common name=4NBA}} |
− | {{#set: common name= | + | {{#set: produced by=RXN0-5141}} |
− | {{#set: produced by= | + |
Revision as of 19:00, 18 March 2018
Contents
Metabolite CPD-702
- smiles:
- C(O)C1(C=CC(=CC=1)[N+]([O-])=O)
- inchi key:
- InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N
- common name:
- 4-nitrobenzyl alcohol
- molecular weight:
- 153.137
- Synonym(s):
- 4NBA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C=CC(=CC=1)[N+]([O-])=O)" cannot be used as a page name in this wiki.