Difference between revisions of "Tiso gene 19905"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Crotonyl-ACPs Crotonyl-ACPs] == * common name: ** a crotonyl-[acp] * Synonym(s): ** a trans-but...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-698 CPD-698] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Crotonyl-ACPs Crotonyl-ACPs] ==
−
* smiles:
+
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
−
* inchi key:
+
−
** InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N
+
 
* common name:
 
* common name:
−
** campest-4-en-3-one
+
** a crotonyl-[acp]
−
* molecular weight:
+
−
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
−
** methylcholestenone
+
** a trans-but-2-enoyl-[acp]
−
** (24R)-24-methyl-cholest-4-en-3-one
+
** a (2E)-but-2-enoyl-[acp]
−
** 3-dehydro-Δ4-5-campesterol
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-711]]
+
* [[RXN-9657]]
−
* [[RXN-4231]]
+
* [[RXN-9515]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[4.2.1.58-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a crotonyl-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11988279 11988279]
+
{{#set: common name=a trans-but-2-enoyl-[acp]|a (2E)-but-2-enoyl-[acp]}}
−
* LIGAND-CPD:
+
{{#set: consumed by=RXN-9657|RXN-9515}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15785 C15785]
+
{{#set: produced by=4.2.1.58-RXN}}
−
* HMDB : HMDB12196
+
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=QQIOPZFVTIHASB-IMUDCKKOSA-N}}
+
−
{{#set: common name=campest-4-en-3-one}}
+
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: common name=methylcholestenone|(24R)-24-methyl-cholest-4-en-3-one|3-dehydro-Δ4-5-campesterol}}
+
−
{{#set: consumed by=RXN-711|RXN-4231}}
+

Revision as of 19:01, 18 March 2018

Metabolite Crotonyl-ACPs

  • common name:
    • a crotonyl-[acp]
  • Synonym(s):
    • a trans-but-2-enoyl-[acp]
    • a (2E)-but-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a crotonyl-[acp" cannot be used as a page name in this wiki.
  • "a trans-but-2-enoyl-[acp" cannot be used as a page name in this wiki.
  • "a (2E)-but-2-enoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19905&oldid=28281"