Difference between revisions of "Tiso gene 12592"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4265 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-esiliculosus == Pathways associated == ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] == * smiles:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] == |
| + | * smiles: | ||
| + | ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8)))) | ||
| + | * common name: | ||
| + | ** 131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester | ||
| + | * molecular weight: | ||
| + | ** 611.959 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-5284]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | * [[RXN-5283]] |
| + | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658440 90658440] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60490 60490] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C11830 C11830] | ||
| + | {{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))}} | ||
| + | {{#set: common name=131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester}} | ||
| + | {{#set: molecular weight=611.959 }} | ||
| + | {{#set: consumed by=RXN-5284}} | ||
| + | {{#set: produced by=RXN-5283}} | ||
Revision as of 19:01, 18 March 2018
Contents
Metabolite 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M
- smiles:
- C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))
- common name:
- 131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester
- molecular weight:
- 611.959
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))" cannot be used as a page name in this wiki.
