Difference between revisions of "RXN-14481"

Revision as of 23:52, 18 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
+== Gene Tiso_gene_2021 ==
-* smiles:
-** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
-* inchi key:
-** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
-* common name:
-** salicyl-6-hydroxy-2-cyclohexene-on-oyl
-* molecular weight:
-** 262.262
 * Synonym(s):
-** salicyl-HCH
-** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
-** acylsaligenin
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-* [[RXN-12252]]
+* [[2.7.1.68-RXN]]
-== Reaction(s) known to produce the compound ==
+** [[pantograph]]-[[athaliana]]
-== Reaction(s) of unknown directionality ==
+== Pathways associated ==
+* [[PWY-6352]]
+* [[PWY-6351]]
 == External links  ==
-* CAS : 529507-98-0
+{{#set: reaction associated=2.7.1.68-RXN}}
-* PUBCHEM:
+{{#set: pathway associated=PWY-6352|PWY-6351}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
-{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
-{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
-{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
-{{#set: molecular weight=262.262    }}
-{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
-{{#set: consumed by=RXN-12252}}