Difference between revisions of "Tiso gene 199"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_13589 == * Synonym(s): == Reactions associated == * 2.4.1.151-RXN ** pantograph-esiliculosus == Pathways associated == * PWY...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13589 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[2.4.1.151-RXN]] |
− | == | + | ** [[pantograph]]-[[esiliculosus]] |
− | * [[ | + | == Pathways associated == |
− | + | * [[PWY-7434]] | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.4.1.151-RXN}} | |
− | + | {{#set: pathway associated=PWY-7434}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 00:01, 19 March 2018
Gene Tiso_gene_13589
- Synonym(s):