Difference between revisions of "CPD-13713"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] == * smiles: ** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Tiso_gene_587 == * left end position: ** 5982 * transcription direction: ** NEGATIVE * right end position: ** 9733 * centisome position: ** 19.189068...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_587 == |
− | * | + | * left end position: |
− | ** | + | ** 5982 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 9733 |
− | * | + | * centisome position: |
− | ** | + | ** 19.189068 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN0-2161]] | |
− | * [[RXN- | + | ** experimental_annotation |
− | == | + | ***ec-number |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
+ | * [[SERINE--TRNA-LIGASE-RXN]] | ||
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[TRNA-CHARGING-PWY]] | ||
+ | * [[PWY0-901]] | ||
+ | * [[PWY-6281]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5982}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=9733}} | |
− | + | {{#set: centisome position=19.189068 }} | |
− | + | {{#set: reaction associated=RXN0-2161|SERINE--TRNA-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=TRNA-CHARGING-PWY|PWY0-901|PWY-6281}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 01:02, 19 March 2018
Gene Tiso_gene_587
- left end position:
- 5982
- transcription direction:
- NEGATIVE
- right end position:
- 9733
- centisome position:
- 19.189068
- Synonym(s):
Reactions associated
- RXN0-2161
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- experimental_annotation
- SERINE--TRNA-LIGASE-RXN
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- experimental_annotation