Difference between revisions of "RXN-10769"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] == * smiles: ** CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14074 RXN-14074] == * direction: ** LEFT-TO-RIGHT * common name: ** adenylate_kinase_domain-con...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15244 CPD-15244] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14074 RXN-14074] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(5Z)-tetradecenoyl-CoA
+
** adenylate_kinase_domain-containing_protein_1
−
* molecular weight:
+
* ec number:
−
** 985.829   
+
** [http://enzyme.expasy.org/EC/2.7.4.4 EC-2.7.4.4]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-5-cis-tetradecenoyl-CoA
 
−
** 3-oxo-14:1-Δ5-CoA
 
−
** 3-keto-5-cis-tetradecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14394]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[GTP]][c] '''+''' 1 [[AMP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[GDP]][c]
−
* [[RXN-14393]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 GTP[c] '''+''' 1 AMP[c] '''=>''' 1 ADP[c] '''+''' 1 GDP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_195]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659295 90659295]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=29864 29864]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87707 87707]
+
{{#set: common name=adenylate_kinase_domain-containing_protein_1}}
−
{{#set: smiles=CCCCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: ec number=EC-2.7.4.4}}
−
{{#set: inchi key=InChIKey=KADPWMJVUVWQNK-STFCKWFXSA-J}}
+
{{#set: gene associated=Tiso_gene_195}}
−
{{#set: common name=3-oxo-(5Z)-tetradecenoyl-CoA}}
+
{{#set: in pathway=}}
−
{{#set: molecular weight=985.829    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=3-oxo-5-cis-tetradecenoyl-CoA|3-oxo-14:1-Δ5-CoA|3-keto-5-cis-tetradecenoyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: consumed by=RXN-14394}}
+
{{#set: reconstruction source=in-silico_annotation}}
−
{{#set: produced by=RXN-14393}}
+

Revision as of 16:01, 10 January 2018

Reaction RXN-14074

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • adenylate_kinase_domain-containing_protein_1
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 GTP[c] + 1 AMP[c] => 1 ADP[c] + 1 GDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-10769&oldid=11264"