Difference between revisions of "Tiso gene 14791"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] == * smiles: ** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-] * inchi key: ** InChIKey=OUYCCCASQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14014 RXN-14014] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14014 RXN-14014] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.17.1.8 EC-1.17.1.8] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [ | + | ** 1 [[NADPH]][c] '''+''' 1 [[CPD-14443]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[DELTA1-PIPERIDEINE-2-6-DICARBOXYLATE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 NADPH[c] '''+''' 1 (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate[c] '''+''' 1 H+[c] '''=>''' 1 (S)-2,3,4,5-tetrahydrodipicolinate[c] '''+''' 1 H2O[c] '''+''' 1 NADP+[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | = | + | * [[Tiso_gene_13314]] |
− | * [[ | + | ** [[pantograph]]-[[synechocystis]] |
− | == | + | ** [[pantograph]]-[[esiliculosus]] |
− | * [[ | + | == Pathways == |
+ | * [[PWY-5097]], L-lysine biosynthesis VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5097 PWY-5097] | ||
+ | ** '''7''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PWY-2942]], L-lysine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2942 PWY-2942] | ||
+ | ** '''6''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[DAPLYSINESYN-PWY]], L-lysine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=DAPLYSINESYN-PWY DAPLYSINESYN-PWY] | ||
+ | ** '''6''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-2941]], L-lysine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2941 PWY-2941] | ||
+ | ** '''6''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04199 R04199] | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04198 R04198] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.17.1.8}} | |
− | * LIGAND- | + | {{#set: gene associated=Tiso_gene_13314}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-5097|PWY-2942|DAPLYSINESYN-PWY|PWY-2941}} |
− | + | {{#set: reconstruction category=orthology|manual}} | |
− | ** [http://www. | + | {{#set: reconstruction source=manual-primary_network|orthology-synechocystis|orthology-esiliculosus}} |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 00:03, 19 March 2018
Contents
Reaction RXN-14014
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NADPH[c] + 1 (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate[c] + 1 H+[c] => 1 (S)-2,3,4,5-tetrahydrodipicolinate[c] + 1 H2O[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-5097, L-lysine biosynthesis VI: PWY-5097
- 7 reactions found over 7 reactions in the full pathway
- PWY-2942, L-lysine biosynthesis III: PWY-2942
- 6 reactions found over 7 reactions in the full pathway
- DAPLYSINESYN-PWY, L-lysine biosynthesis I: DAPLYSINESYN-PWY
- 6 reactions found over 9 reactions in the full pathway
- PWY-2941, L-lysine biosynthesis II: PWY-2941
- 6 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-synechocystis
- Category: manual
- Source: manual-primary_network
External links