Difference between revisions of "CPD-14419"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14736 CPD-14736] == * smiles: ** C(=O)([O-])C([N+])CC(=O)C1(=C(N)C=CC=C1) * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Tiso_gene_807 == * left end position: ** 17569 * transcription direction: ** POSITIVE * right end position: ** 18544 * centisome position: ** 61.3464...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_807 == |
| − | * | + | * left end position: |
| − | ** | + | ** 17569 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 18544 |
| − | * | + | * centisome position: |
| − | ** | + | ** 61.346416 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]] |
| − | * | + | ** in-silico_annotation |
| − | + | ***ec-number | |
| − | * | + | == Pathways associated == |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=17569}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: right end position=18544}} | |
| − | + | {{#set: centisome position=61.346416 }} | |
| − | + | {{#set: reaction associated=PROTEIN-TYROSINE-PHOSPHATASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Revision as of 00:04, 19 March 2018
Gene Tiso_gene_807
- left end position:
- 17569
- transcription direction:
- POSITIVE
- right end position:
- 18544
- centisome position:
- 61.346416
- Synonym(s):
Reactions associated
- PROTEIN-TYROSINE-PHOSPHATASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
