Difference between revisions of "Oxidized-Plastocyanins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * smiles: ** C3(C=C(O)C=CC(C1(=C([O-])C(=O)C2(C(O)=CC(O)=CC(O1)=2)))=3) *...") |
(Created page with "Category:Gene == Gene Tiso_gene_11824 == * left end position: ** 3821 * transcription direction: ** NEGATIVE * right end position: ** 6117 * centisome position: ** 50.9942...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_11824 == |
| − | * | + | * left end position: |
| − | ** | + | ** 3821 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 6117 |
| − | * | + | * centisome position: |
| − | ** | + | ** 50.99426 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[RXN | + | * [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]] |
| − | * | + | ** in-silico_annotation |
| − | == | + | ***ec-number |
| − | * [[ | + | == Pathways associated == |
| − | + | * [[TRIGLSYN-PWY]] | |
== External links == | == External links == | ||
| − | + | {{#set: left end position=3821}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | + | {{#set: right end position=6117}} | |
| − | + | {{#set: centisome position=50.99426 }} | |
| − | + | {{#set: reaction associated=DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN}} | |
| − | + | {{#set: pathway associated=TRIGLSYN-PWY}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 00:05, 19 March 2018
Gene Tiso_gene_11824
- left end position:
- 3821
- transcription direction:
- NEGATIVE
- right end position:
- 6117
- centisome position:
- 50.99426
- Synonym(s):
Reactions associated
- DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
