Difference between revisions of "DTDPGLUCOSEPP-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == * smiles: ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin...") |
(Created page with "Category:Gene == Gene Tiso_gene_19352 == * left end position: ** 124 * transcription direction: ** POSITIVE * right end position: ** 854 * centisome position: ** 5.1861143...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_19352 == |
| − | * | + | * left end position: |
| − | ** | + | ** 124 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| + | * right end position: | ||
| + | ** 854 | ||
| + | * centisome position: | ||
| + | ** 5.1861143 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]] | |
| − | == | + | ** [[pantograph]]-[[esiliculosus]] |
| − | * [[ | + | * [[R06859]] |
| + | ** [[pantograph]]-[[synechocystis]] | ||
| + | * [[RXN-11046]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | * [[RXN-14177]] | ||
| + | ** [[pantograph]]-[[athaliana]] | ||
| + | * [[RXN-9235]] | ||
| + | ** in-silico_annotation | ||
| + | ***automated-name-match | ||
| + | == Pathways associated == | ||
| + | * [[PWY-6708]] | ||
| + | * [[PWY-5872]] | ||
| + | * [[PWY-5870]] | ||
| + | * [[PWY-5857]] | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=124}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: right end position=854}} |
| − | {{#set: | + | {{#set: centisome position=5.1861143 }} |
| − | {{#set: | + | {{#set: reaction associated=2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN|R06859|RXN-11046|RXN-14177|RXN-9235}} |
| + | {{#set: pathway associated=PWY-6708|PWY-5872|PWY-5870|PWY-5857}} | ||
Revision as of 00:05, 19 March 2018
Gene Tiso_gene_19352
- left end position:
- 124
- transcription direction:
- POSITIVE
- right end position:
- 854
- centisome position:
- 5.1861143
- Synonym(s):
Reactions associated
- 2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN
- R06859
- RXN-11046
- RXN-14177
- RXN-9235
- in-silico_annotation
- automated-name-match
- in-silico_annotation
