Difference between revisions of "RXN-12037"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == * smiles: ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18205 RXN-18205] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18205 RXN-18205] ==
−
* smiles:
+
* direction:
−
** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
+
−
* common name:
+
−
** pelargonidin-3,5-di-O-β-D-glucoside
+
−
* molecular weight:
+
−
** 594.525   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-7828]]
+
** 1 [[CPD-19489]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPDQT-29]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3-isopropyl-8-(methylthio)-2-oxooctanoate[c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 8-(methylthio)-2-oxooctanoate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWYQT-4450]], aliphatic glucosinolate biosynthesis, side chain elongation cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4450 PWYQT-4450]
 +
** '''10''' reactions found over '''30''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167643 167643]
+
{{#set: in pathway=PWYQT-4450}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57503 57503]
+
{{#set: reconstruction source=annotation-experimental_annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08725 C08725]
+
−
* HMDB : HMDB33681
+
−
{{#set: smiles=C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)}}
+
−
{{#set: inchi key=InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N}}
+
−
{{#set: common name=pelargonidin-3,5-di-O-β-D-glucoside}}
+
−
{{#set: molecular weight=594.525    }}
+
−
{{#set: produced by=RXN-7828}}
+

Revision as of 00:07, 19 March 2018

Reaction RXN-18205

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3-isopropyl-8-(methylthio)-2-oxooctanoate[c] + 1 H+[c] => 1 CO2[c] + 1 8-(methylthio)-2-oxooctanoate[c]

Genes associated with this reaction

Pathways

  • PWYQT-4450, aliphatic glucosinolate biosynthesis, side chain elongation cycle: PWYQT-4450
    • 10 reactions found over 30 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12037&oldid=28778"