Difference between revisions of "7-8-DIHYDROPTEROATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11521 CPD-11521] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Gene == Gene Tiso_gene_13809 == * left end position: ** 218 * transcription direction: ** NEGATIVE * right end position: ** 5206 * centisome position: ** 3.605689...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11521 CPD-11521] ==
+
== Gene Tiso_gene_13809 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** 218
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VWFUYQVGVAEVNH-CNALLRBTSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** OPC6-CoA
+
** 5206
−
* molecular weight:
+
* centisome position:
−
** 1011.867    
+
** 3.6056898    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10706]]
+
* [[ASPARTATEKIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[RXN-10699]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[HOMOSERSYN-PWY]]
 +
* [[PWY-7153]]
 +
* [[DAPLYSINESYN-PWY]]
 +
* [[PWY-2942]]
 +
* [[PWY-2941]]
 +
* [[PWY-6559]]
 +
* [[PWY-5097]]
 +
* [[PWY-6562]]
 +
* [[P101-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=218}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237133 44237133]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: right end position=5206}}
−
{{#set: inchi key=InChIKey=VWFUYQVGVAEVNH-CNALLRBTSA-J}}
+
{{#set: centisome position=3.6056898   }}
−
{{#set: common name=OPC6-CoA}}
+
{{#set: reaction associated=ASPARTATEKIN-RXN}}
−
{{#set: molecular weight=1011.867   }}
+
{{#set: pathway associated=HOMOSERSYN-PWY|PWY-7153|DAPLYSINESYN-PWY|PWY-2942|PWY-2941|PWY-6559|PWY-5097|PWY-6562|P101-PWY}}
−
{{#set: consumed by=RXN-10706}}
+
−
{{#set: produced by=RXN-10699}}
+

Revision as of 00:07, 19 March 2018

Gene Tiso_gene_13809

  • left end position:
    • 218
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5206
  • centisome position:
    • 3.6056898
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=7-8-DIHYDROPTEROATE&oldid=28829"