Difference between revisions of "34HPPYRI"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] == * smiles: ** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_13558 == * left end position: ** 174 * transcription direction: ** POSITIVE * right end position: ** 3312 * centisome position: ** 2.796079...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13558 == |
− | * | + | * left end position: |
− | ** | + | ** 174 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3312 |
− | * | + | * centisome position: |
− | ** | + | ** 2.796079 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * [[FORMAMIDASE-RXN]] | |
− | == | + | ** in-silico_annotation |
− | * [[ | + | ***automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-7142]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=174}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3312}} | |
− | + | {{#set: centisome position=2.796079 }} | |
− | + | {{#set: reaction associated=FORMAMIDASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7142}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 00:10, 19 March 2018
Gene Tiso_gene_13558
- left end position:
- 174
- transcription direction:
- POSITIVE
- right end position:
- 3312
- centisome position:
- 2.796079
- Synonym(s):
Reactions associated
- FORMAMIDASE-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation