Difference between revisions of "AICARTRANSFORM-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] * inchi key: ** InChIKey=HOB...") |
(Created page with "Category:Gene == Gene Tiso_gene_794 == * left end position: ** 14905 * transcription direction: ** POSITIVE * right end position: ** 18943 * centisome position: ** 51.8958...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_794 == |
− | * | + | * left end position: |
− | ** | + | ** 14905 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 18943 |
− | * | + | * centisome position: |
− | ** | + | ** 51.89583 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[UREASE-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | == | + | ***ec-number |
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5704]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=14905}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=18943}} | |
− | + | {{#set: centisome position=51.89583 }} | |
− | + | {{#set: reaction associated=UREASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-5704}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 00:10, 19 March 2018
Gene Tiso_gene_794
- left end position:
- 14905
- transcription direction:
- POSITIVE
- right end position:
- 18943
- centisome position:
- 51.89583
- Synonym(s):
Reactions associated
- UREASE-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- in-silico_annotation