Difference between revisions of "Tiso gene 15467"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_8616 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-esiliculosus * RXN-8443 ** pantograp...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8616 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[PROTEIN-KINASE-RXN]] | |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
− | == | + | * [[RXN-8443]] |
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-8626]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5381]] | ||
+ | * [[PWY-5443]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN|RXN-8443|RXN-8626}} | |
− | + | {{#set: pathway associated=PWY-5381|PWY-5443}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 00:13, 19 March 2018
Gene Tiso_gene_8616
- Synonym(s):