Difference between revisions of "Tiso gene 6635"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * smiles: ** C1(=CC=C(C=C1)[N+]([O-])=O) * inchi key: ** InChIKey=L...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8350 RXN-8350] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8350 RXN-8350] ==
−
* smiles:
+
* direction:
−
** C1(=CC=C(C=C1)[N+]([O-])=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=LQNUZADURLCDLV-UHFFFAOYSA-N
+
** [http://enzyme.expasy.org/EC/1.14.19.30 EC-1.14.19.30]
−
* common name:
+
−
** nitrobenzene
+
−
* molecular weight:
+
−
** 123.111   
+
 
* Synonym(s):
 
* Synonym(s):
−
** benzene-NO2
 
−
** nitro-benzene
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-3661]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-17281]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[CPD-17282]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a [glycerolipid]-icosatetraenoate[c] '''+''' 1 oxygen[c] '''+''' 2 H+[c] '''+''' 2 a ferrocytochrome b5[c] '''=>''' 2 H2O[c] '''+''' 1 a [glycerolipid]-icosapentaenoate[c] '''+''' 2 a ferricytochrome b5[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7602]], icosapentaenoate biosynthesis V (8-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7602 PWY-7602]
 +
** '''7''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-6958]], icosapentaenoate biosynthesis I (lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6958 PWY-6958]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 98-95-3
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.14.19.30}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7416 7416]
+
{{#set: in pathway=PWY-7602|PWY-6958}}
−
* HMDB : HMDB41950
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06813 C06813]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.7138.html 7138]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27798 27798]
+
−
{{#set: smiles=C1(=CC=C(C=C1)[N+]([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=LQNUZADURLCDLV-UHFFFAOYSA-N}}
+
−
{{#set: common name=nitrobenzene}}
+
−
{{#set: molecular weight=123.111    }}
+
−
{{#set: common name=benzene-NO2|nitro-benzene}}
+
−
{{#set: consumed by=RXN-3661}}
+

Revision as of 00:13, 19 March 2018

Reaction RXN-8350

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7602, icosapentaenoate biosynthesis V (8-desaturase, lower eukaryotes): PWY-7602
    • 7 reactions found over 7 reactions in the full pathway
  • PWY-6958, icosapentaenoate biosynthesis I (lower eukaryotes): PWY-6958
    • 2 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6635&oldid=29248"