Difference between revisions of "RXN-775"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * inchi key: ** InChIKey=HNDVDQJCIGZPNO-Y...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTKIN-RXN GLUTKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** glutamate_5-kinase ** a...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTKIN-RXN GLUTKIN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** glutamate_5-kinase |
− | * | + | ** aspartokinase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.7.2.11 EC-2.7.2.11] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[GLT]][c] '''=>''' 1 [[L-GLUTAMATE-5-P]][c] '''+''' 1 [[ADP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 ATP[c] '''+''' 1 L-glutamate[c] '''=>''' 1 γ-L-glutamyl 5-phosphate[c] '''+''' 1 ADP[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | == | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * [[Tiso_gene_12021]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | ** EXPERIMENTAL_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[Tiso_gene_16634]] | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[Tiso_gene_17057]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6922]], L-Nδ-acetylornithine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6922 PWY-6922] | ||
+ | ** '''6''' reactions found over '''7''' reactions in the full pathway | ||
+ | * [[PROSYN-PWY]], L-proline biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PROSYN-PWY PROSYN-PWY] | ||
+ | ** '''4''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[ARGININE-SYN4-PWY]], L-ornithine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=ARGININE-SYN4-PWY ARGININE-SYN4-PWY] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-3341]], L-proline biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3341 PWY-3341] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[CITRULBIO-PWY]], L-citrulline biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=CITRULBIO-PWY CITRULBIO-PWY] | ||
+ | ** '''8''' reactions found over '''8''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14877 14877] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00239 R00239] |
− | + | * UNIPROT: | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/Q9PJ29 Q9PJ29] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q9CF72 Q9CF72] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JUK7 Q9JUK7] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P43763 P43763] |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A7B5 P0A7B5] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P17856 P17856] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P32264 P32264] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P73071 P73071] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O04226 O04226] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O13810 O13810] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P46546 P46546] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
+ | {{#set: common name=glutamate_5-kinase}} | ||
+ | {{#set: common name=aspartokinase}} | ||
+ | {{#set: ec number=EC-2.7.2.11}} | ||
+ | {{#set: gene associated=Tiso_gene_12021|Tiso_gene_16634|Tiso_gene_17057}} | ||
+ | {{#set: in pathway=PWY-6922|PROSYN-PWY|ARGININE-SYN4-PWY|PWY-3341|CITRULBIO-PWY}} | ||
+ | {{#set: reconstruction category=orthology|manual|annotation}} | ||
+ | {{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network|orthology-creinhardtii}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 00:14, 19 March 2018
Contents
Reaction GLUTKIN-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- glutamate_5-kinase
- aspartokinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 GLT[c] => 1 L-GLUTAMATE-5-P[c] + 1 ADP[c]
- With common name(s):
- 1 ATP[c] + 1 L-glutamate[c] => 1 γ-L-glutamyl 5-phosphate[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_12021
- IN-SILICO_ANNOTATION
- EC-NUMBER
- EXPERIMENTAL_ANNOTATION
- EC-NUMBER
- pantograph-synechocystis
- pantograph-creinhardtii
- IN-SILICO_ANNOTATION
- Tiso_gene_16634
- Tiso_gene_17057
- IN-SILICO_ANNOTATION
- EC-NUMBER
- pantograph-esiliculosus
- IN-SILICO_ANNOTATION
Pathways
- PWY-6922, L-Nδ-acetylornithine biosynthesis: PWY-6922
- 6 reactions found over 7 reactions in the full pathway
- PROSYN-PWY, L-proline biosynthesis I: PROSYN-PWY
- 4 reactions found over 4 reactions in the full pathway
- ARGININE-SYN4-PWY, L-ornithine biosynthesis II: ARGININE-SYN4-PWY
- 3 reactions found over 4 reactions in the full pathway
- PWY-3341, L-proline biosynthesis III: PWY-3341
- 5 reactions found over 5 reactions in the full pathway
- CITRULBIO-PWY, L-citrulline biosynthesis: CITRULBIO-PWY
- 8 reactions found over 8 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: